CAS 116153-81-2 appears in our catalog under these names: 5-Furan-2-yl-2 H -pyrazole-3-carboxylic acid, 97%, 5-(2-Furyl)-1H-pyrazole-3-carboxylic acid, 97% , 5-(Furan-2-yl)-1H-pyrazole-3-carboxylic acid, 98%, 98%. Offered by: Fluorochem, Thermo Scientific, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
5-(furan-2-yl)-1H-pyrazole-3-carboxylic acid (CAS 116153-81-2) is a chemical compound with the molecular formula C8H6N2O3 and a molecular weight of 178.14 g/mol. IUPAC name: 5-(furan-2-yl)-1H-pyrazole-3-carboxylic acid. InChIKey: GKPSFQIKCROJOB-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 5-(furan-2-yl)-1H-pyrazole-3-carboxylic acid |
| InChIKey | GKPSFQIKCROJOB-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=CC(=NN2)C(=O)O |
Computed by PubChem (NCBI)