CAS 1161602-22-7 appears in our catalog under these names: Cbz-DL-Pro-OH 97%, 1-(Phenoxycarbonyl)pyrrolidine-2-carboxylic acid, 97%, 97%, 1-(Phenoxycarbonyl)pyrrolidine-2-carboxylic acid, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg.
1-phenoxycarbonylpyrrolidine-2-carboxylic acid (CAS 1161602-22-7) is a chemical compound with the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. IUPAC name: 1-phenoxycarbonylpyrrolidine-2-carboxylic acid. InChIKey: OUPMLYISWFZSNV-UHFFFAOYSA-N.
| Molecular formula | C12H13NO4 |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | 1-phenoxycarbonylpyrrolidine-2-carboxylic acid |
| InChIKey | OUPMLYISWFZSNV-UHFFFAOYSA-N |
| SMILES | C1CC(N(C1)C(=O)OC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)