CAS 116194-21-9 appears in our catalog under these names: Boc-dl-ile-oh, 95%, rel-(tert-Butoxycarbonyl)-isoleucine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
(2S,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 116194-21-9) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: (2S,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: QJCNLJWUIOIMMF-YUMQZZPRSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | (2S,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | QJCNLJWUIOIMMF-YUMQZZPRSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)