CAS 55780-90-0 appears in our catalog under these names: Boc-D-Allo-Ile-OH, 95+%, Boc–D–Allo–Ile–OH, N-tert-Butoxycarbonyl-D-alloisoleucine, 98%, 98%, Boc-D-allo-Ile-OH, 97%, Boc-D-Allo-Ile-OH, 98%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 250mg, 100mg, 10g.
(2R,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 55780-90-0) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: (2R,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: QJCNLJWUIOIMMF-JGVFFNPUSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | (2R,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | QJCNLJWUIOIMMF-JGVFFNPUSA-N |
| SMILES | CC[C@H](C)[C@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)