CAS 1162262-04-5 appears in our catalog under these names: 4-Bromo-7-methoxy-2,3-dihydro-1H-indol-2-one, 97%, 4-Bromo-7-methoxyindolin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 10g, 250mg, 5g, 0,5g, 50mg.
4-bromo-7-methoxy-1,3-dihydroindol-2-one (CAS 1162262-04-5) is a chemical compound with the molecular formula C9H8BrNO2 and a molecular weight of 242.07 g/mol. IUPAC name: 4-bromo-7-methoxy-1,3-dihydroindol-2-one. InChIKey: ZUBWLSZCSDOILE-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO2 |
|---|---|
| Molecular weight | 242.07 g/mol |
| IUPAC name | 4-bromo-7-methoxy-1,3-dihydroindol-2-one |
| InChIKey | ZUBWLSZCSDOILE-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=C(C=C1)Br)CC(=O)N2 |
Computed by PubChem (NCBI)