CAS 116247-03-1 appears in our catalog under these names: 2-Pyrid-3-yl-4,5-dihydro-1,3-thiazole-4-carboxylic acid, 97% , 2-(Pyridin-3-yl)-4,5-dihydrothiazole-4-carboxylic acid, 98%, 98%, 2-(Pyridin-3-yl)-4,5-dihydrothiazole-4-carboxylic acid, 98%. Offered by: Thermo Scientific, Chemat, Fluorochem. Available pack sizes: 250MG, 1g, 100mg.
2-pyridin-3-yl-4,5-dihydro-1,3-thiazole-4-carboxylic acid (CAS 116247-03-1) is a chemical compound with the molecular formula C9H8N2O2S and a molecular weight of 208.24 g/mol. IUPAC name: 2-pyridin-3-yl-4,5-dihydro-1,3-thiazole-4-carboxylic acid. InChIKey: LJGAQGZEJDQDAU-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2S |
|---|---|
| Molecular weight | 208.24 g/mol |
| IUPAC name | 2-pyridin-3-yl-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| InChIKey | LJGAQGZEJDQDAU-UHFFFAOYSA-N |
| SMILES | C1C(N=C(S1)C2=CN=CC=C2)C(=O)O |
Computed by PubChem (NCBI)