Products 870761-06-1
CAS 870761-06-1 appears in our catalog under these names: 1-(2,3-Dihydro-1,4-benzodioxin-6-yl)-2,2,2-trifluoroethan-1-amine, 1-(2,3-Dihydro-1,4-benzodioxin-6-yl)-2,2,2-trifluoroethan-1-amine, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 0,5g, 50mg, 250mg, 1g.
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,2,2-trifluoroethanamine (CAS 870761-06-1) is a chemical compound with the molecular formula C10H10F3NO2 and a molecular weight of 233.19 g/mol. IUPAC name: 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,2,2-trifluoroethanamine. InChIKey: NUQMLXJXZQWPFY-UHFFFAOYSA-N.
| Molecular formula | C10H10F3NO2 |
|---|---|
| Molecular weight | 233.19 g/mol |
| IUPAC name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,2,2-trifluoroethanamine |
| InChIKey | NUQMLXJXZQWPFY-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)C(C(F)(F)F)N |
Computed by PubChem (NCBI)