CAS 116419-36-4 appears in our catalog under these names: (3-Nitro-1h-1,2,4-triazol-1-yl)acetic acid, 95%, 2-(3-Nitro-1H-1,2,4-triazol-1-yl)acetic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.
2-(3-nitro-1,2,4-triazol-1-yl)acetic acid (CAS 116419-36-4) is a chemical compound with the molecular formula C4H4N4O4 and a molecular weight of 172.10 g/mol. IUPAC name: 2-(3-nitro-1,2,4-triazol-1-yl)acetic acid. InChIKey: JNJSKDYVVRMEPN-UHFFFAOYSA-N.
| Molecular formula | C4H4N4O4 |
|---|---|
| Molecular weight | 172.10 g/mol |
| IUPAC name | 2-(3-nitro-1,2,4-triazol-1-yl)acetic acid |
| InChIKey | JNJSKDYVVRMEPN-UHFFFAOYSA-N |
| SMILES | C1=NC(=NN1CC(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)