CAS 66296-67-1 appears in our catalog under these names: 1–Methyl–3,4–Dinitro–1H–Pyrazole, 1-Methyl-3,4-dinitro-1H-pyrazole. Offered by: GLPBio, Biosynth. Available pack sizes: 100mg, 1g, 250mg.
1-methyl-3,4-dinitropyrazole (CAS 66296-67-1) is a chemical compound with the molecular formula C4H4N4O4 and a molecular weight of 172.10 g/mol. IUPAC name: 1-methyl-3,4-dinitropyrazole. InChIKey: VDTOUIPOAUVOLP-UHFFFAOYSA-N.
| Molecular formula | C4H4N4O4 |
|---|---|
| Molecular weight | 172.10 g/mol |
| IUPAC name | 1-methyl-3,4-dinitropyrazole |
| InChIKey | VDTOUIPOAUVOLP-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)