CAS 19182-82-2 is the registry number for 2-Methyl-1,4-dinitroimidazole. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-1,4-dinitroimidazole (CAS 19182-82-2) is a chemical compound with the molecular formula C4H4N4O4 and a molecular weight of 172.10 g/mol. IUPAC name: 2-methyl-1,4-dinitroimidazole. InChIKey: BVFZUJRMDAZULW-UHFFFAOYSA-N.
| Molecular formula | C4H4N4O4 |
|---|---|
| Molecular weight | 172.10 g/mol |
| IUPAC name | 2-methyl-1,4-dinitroimidazole |
| InChIKey | BVFZUJRMDAZULW-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CN1[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)