CAS 19183-16-5 appears in our catalog under these names: 2-Methyl-4,5-dinitroimidazole, 2-methyl-4,5-dinitro-1H-imidazole, Ornidazole Impurity 15. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-methyl-4,5-dinitro-1H-imidazole (CAS 19183-16-5) is a chemical compound with the molecular formula C4H4N4O4 and a molecular weight of 172.10 g/mol. IUPAC name: 2-methyl-4,5-dinitro-1H-imidazole. InChIKey: MGUZJNXSLXRCLT-UHFFFAOYSA-N.
| Molecular formula | C4H4N4O4 |
|---|---|
| Molecular weight | 172.10 g/mol |
| IUPAC name | 2-methyl-4,5-dinitro-1H-imidazole |
| InChIKey | MGUZJNXSLXRCLT-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(N1)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)