CAS 80466-56-4 appears in our catalog under these names: 2-Amino-4,6-dihydroxy-5-nitropyrimidine, 2-Amino-5-nitropyrimidine-4,6-diol, 95%. Offered by: TRC, AmBeed. Available pack sizes: 100mg, 1g, 500mg.
2-amino-4-hydroxy-5-nitro-1H-pyrimidin-6-one (CAS 80466-56-4) is a chemical compound with the molecular formula C4H4N4O4 and a molecular weight of 172.10 g/mol. IUPAC name: 2-amino-4-hydroxy-5-nitro-1H-pyrimidin-6-one. InChIKey: ZEBYRLPUWQNZNY-UHFFFAOYSA-N.
| Molecular formula | C4H4N4O4 |
|---|---|
| Molecular weight | 172.10 g/mol |
| IUPAC name | 2-amino-4-hydroxy-5-nitro-1H-pyrimidin-6-one |
| InChIKey | ZEBYRLPUWQNZNY-UHFFFAOYSA-N |
| SMILES | C1(=C(N=C(NC1=O)N)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)