Products 116435-75-7
CAS 116435-75-7 appears in our catalog under these names: 3-Ethoxy-4-nitroaniline, 95%, 3-Ethoxy-4-nitroaniline, 95+%, 3-ethoxy-4-nitroaniline, 3-Ethoxy-4-nitroaniline, ≥95%, ≥95%, 3-ETHOXY-4-NITROANILINE, ≥95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
3-ethoxy-4-nitroaniline (CAS 116435-75-7) is a chemical compound with the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. IUPAC name: 3-ethoxy-4-nitroaniline. InChIKey: PQKLWSDPMIJHSY-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O3 |
|---|---|
| Molecular weight | 182.18 g/mol |
| IUPAC name | 3-ethoxy-4-nitroaniline |
| InChIKey | PQKLWSDPMIJHSY-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)