Products 116655-36-8
CAS 116655-36-8 is the registry number for 1,1,1-Trifluoro-3-(pyrazin-2-yl)propan-2-one, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1,1,1-trifluoro-3-pyrazin-2-ylpropan-2-one (CAS 116655-36-8) is a chemical compound with the molecular formula C7H5F3N2O and a molecular weight of 190.12 g/mol. IUPAC name: 1,1,1-trifluoro-3-pyrazin-2-ylpropan-2-one. InChIKey: NSMPTFGSBMYHKW-UHFFFAOYSA-N.
| Molecular formula | C7H5F3N2O |
|---|---|
| Molecular weight | 190.12 g/mol |
| IUPAC name | 1,1,1-trifluoro-3-pyrazin-2-ylpropan-2-one |
| InChIKey | NSMPTFGSBMYHKW-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=N1)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)