CAS 22245-86-9 appears in our catalog under these names: 5-(Trifluoromethyl)picolinamide, 95%, 5–(Trifluoromethyl)picolinamide. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg.
5-(trifluoromethyl)pyridine-2-carboxamide (CAS 22245-86-9) is a chemical compound with the molecular formula C7H5F3N2O and a molecular weight of 190.12 g/mol. IUPAC name: 5-(trifluoromethyl)pyridine-2-carboxamide. InChIKey: JUNJVRHWOHOSKU-UHFFFAOYSA-N.
| Molecular formula | C7H5F3N2O |
|---|---|
| Molecular weight | 190.12 g/mol |
| IUPAC name | 5-(trifluoromethyl)pyridine-2-carboxamide |
| InChIKey | JUNJVRHWOHOSKU-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(F)(F)F)C(=O)N |
Computed by PubChem (NCBI)