CAS 903872-56-0 is the registry number for 1-(4-(Trifluoromethyl)pyridazin-3-yl)ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-[4-(trifluoromethyl)pyridazin-3-yl]ethanone (CAS 903872-56-0) is a chemical compound with the molecular formula C7H5F3N2O and a molecular weight of 190.12 g/mol. IUPAC name: 1-[4-(trifluoromethyl)pyridazin-3-yl]ethanone. InChIKey: DZDXPMIQCLKSAK-UHFFFAOYSA-N.
| Molecular formula | C7H5F3N2O |
|---|---|
| Molecular weight | 190.12 g/mol |
| IUPAC name | 1-[4-(trifluoromethyl)pyridazin-3-yl]ethanone |
| InChIKey | DZDXPMIQCLKSAK-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CN=N1)C(F)(F)F |
Computed by PubChem (NCBI)