CAS 1263064-36-3 is the registry number for 3,4,5-Trifluorobenzohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3,4,5-trifluorobenzohydrazide (CAS 1263064-36-3) is a chemical compound with the molecular formula C7H5F3N2O and a molecular weight of 190.12 g/mol. IUPAC name: 3,4,5-trifluorobenzohydrazide. InChIKey: OBNAXEXVXCKFQO-UHFFFAOYSA-N.
| Molecular formula | C7H5F3N2O |
|---|---|
| Molecular weight | 190.12 g/mol |
| IUPAC name | 3,4,5-trifluorobenzohydrazide |
| InChIKey | OBNAXEXVXCKFQO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)F)C(=O)NN |
Computed by PubChem (NCBI)