CAS 885954-61-0 is the registry number for 3,4,5-Trifluoro-n'-hydroxybenzene-1-carboximidamide, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 5g, 10g, 250mg, 1g.
3,4,5-trifluoro-N'-hydroxybenzenecarboximidamide (CAS 885954-61-0) is a chemical compound with the molecular formula C7H5F3N2O and a molecular weight of 190.12 g/mol. IUPAC name: 3,4,5-trifluoro-N'-hydroxybenzenecarboximidamide. InChIKey: XISYIMDGWUAPEU-UHFFFAOYSA-N.
| Molecular formula | C7H5F3N2O |
|---|---|
| Molecular weight | 190.12 g/mol |
| IUPAC name | 3,4,5-trifluoro-N'-hydroxybenzenecarboximidamide |
| InChIKey | XISYIMDGWUAPEU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)F)/C(=N/O)/N |
Computed by PubChem (NCBI)