CAS 1280538-35-3 is the registry number for N-{[3-(Trifluoromethyl)pyridin-2-yl]methylidene}hydroxylamine, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(NE)-N-[[3-(trifluoromethyl)-2-pyridinyl]methylidene]hydroxylamine (CAS 1280538-35-3) is a chemical compound with the molecular formula C7H5F3N2O and a molecular weight of 190.12 g/mol. IUPAC name: (NE)-N-[[3-(trifluoromethyl)-2-pyridinyl]methylidene]hydroxylamine. InChIKey: CGVPECRRBNDRGT-UUILKARUSA-N.
| Molecular formula | C7H5F3N2O |
|---|---|
| Molecular weight | 190.12 g/mol |
| IUPAC name | (NE)-N-[[3-(trifluoromethyl)-2-pyridinyl]methylidene]hydroxylamine |
| InChIKey | CGVPECRRBNDRGT-UUILKARUSA-N |
| SMILES | C1=CC(=C(N=C1)/C=N/O)C(F)(F)F |
Computed by PubChem (NCBI)