Products 1166756-84-8
CAS 1166756-84-8 is the registry number for Ethyl 4-(5-isopropyl-1,2,4-oxadiazol-3-yl)benzoate, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
Ethyl 4-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)benzoate (CAS 1166756-84-8) is a chemical compound with the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. IUPAC name: ethyl 4-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)benzoate. InChIKey: CMVZZJVJFHEEGS-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O3 |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | ethyl 4-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)benzoate |
| InChIKey | CMVZZJVJFHEEGS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)C2=NOC(=N2)C(C)C |
Computed by PubChem (NCBI)