CAS 1167434-38-9 is the registry number for 2,4-dibutoxy-1-nitrobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2,4-dibutoxy-1-nitrobenzene (CAS 1167434-38-9) is a chemical compound with the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. IUPAC name: 2,4-dibutoxy-1-nitrobenzene. InChIKey: RUQCYJGJUOQYDN-UHFFFAOYSA-N.
| Molecular formula | C14H21NO4 |
|---|---|
| Molecular weight | 267.32 g/mol |
| IUPAC name | 2,4-dibutoxy-1-nitrobenzene |
| InChIKey | RUQCYJGJUOQYDN-UHFFFAOYSA-N |
| SMILES | CCCCOC1=CC(=C(C=C1)[N+](=O)[O-])OCCCC |
Computed by PubChem (NCBI)