CAS 116850-44-3 is the registry number for MDL-27531. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-methyl-3-methylsulfonyl-5-phenyl-1,2,4-triazole (CAS 116850-44-3) is a chemical compound with the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. IUPAC name: 4-methyl-3-methylsulfonyl-5-phenyl-1,2,4-triazole. InChIKey: DPGDRICHXKQXEN-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O2S |
|---|---|
| Molecular weight | 237.28 g/mol |
| IUPAC name | 4-methyl-3-methylsulfonyl-5-phenyl-1,2,4-triazole |
| InChIKey | DPGDRICHXKQXEN-UHFFFAOYSA-N |
| SMILES | CN1C(=NN=C1S(=O)(=O)C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)