Products 116856-71-4

CAS 116856-71-4 is the registry number for tert-Butyl 3-(4-(2-Amino-ethyl)-phenyl)-propionate Hydrochloride. Offered by: TRC. Available pack sizes: 500mg.

Structural formula: {0} (CAS {1})

Tert-butyl 3-[4-(2-aminoethyl)phenyl]propanoate;hydrochloride (CAS 116856-71-4) is a chemical compound with the molecular formula C15H24ClNO2 and a molecular weight of 285.81 g/mol. IUPAC name: tert-butyl 3-[4-(2-aminoethyl)phenyl]propanoate;hydrochloride. InChIKey: RFZJDCBUTHGFGB-UHFFFAOYSA-N.

Identity
Molecular formulaC15H24ClNO2
Molecular weight285.81 g/mol
IUPAC nametert-butyl 3-[4-(2-aminoethyl)phenyl]propanoate;hydrochloride
InChIKeyRFZJDCBUTHGFGB-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)CCC1=CC=C(C=C1)CCN.Cl

Computed by PubChem (NCBI)