Products 1170229-53-4

CAS 1170229-53-4 appears in our catalog under these names: 2-(4-Methyl-2-phenylquinolin-3-yl)acetic acid hydrochloride, 95%, 2-(4-Methyl-2-phenylquinolin-3-yl)acetic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.

Structural formula: {0} (CAS {1})

2-(4-methyl-2-phenylquinolin-3-yl)acetic acid;hydrochloride (CAS 1170229-53-4) is a chemical compound with the molecular formula C18H16ClNO2 and a molecular weight of 313.8 g/mol. IUPAC name: 2-(4-methyl-2-phenylquinolin-3-yl)acetic acid;hydrochloride. InChIKey: OQQCFDHQVZNSEA-UHFFFAOYSA-N.

Identity
Molecular formulaC18H16ClNO2
Molecular weight313.8 g/mol
IUPAC name2-(4-methyl-2-phenylquinolin-3-yl)acetic acid;hydrochloride
InChIKeyOQQCFDHQVZNSEA-UHFFFAOYSA-N
SMILESCC1=C(C(=NC2=CC=CC=C12)C3=CC=CC=C3)CC(=O)O.Cl

Computed by PubChem (NCBI)