Products 219544-54-4
CAS 219544-54-4 appears in our catalog under these names: 3-(1-[(4-Chlorophenyl)methyl]-1h-indol-3-yl)propanoic acid, 95%, 3-{1-((4-Chlorophenyl)methyl)-1H-indol-3-yl}propanoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
3-[1-[(4-chlorophenyl)methyl]indol-3-yl]propanoic acid (CAS 219544-54-4) is a chemical compound with the molecular formula C18H16ClNO2 and a molecular weight of 313.8 g/mol. IUPAC name: 3-[1-[(4-chlorophenyl)methyl]indol-3-yl]propanoic acid. InChIKey: FIAKLGDVKKJABU-UHFFFAOYSA-N.
| Molecular formula | C18H16ClNO2 |
|---|---|
| Molecular weight | 313.8 g/mol |
| IUPAC name | 3-[1-[(4-chlorophenyl)methyl]indol-3-yl]propanoic acid |
| InChIKey | FIAKLGDVKKJABU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2CC3=CC=C(C=C3)Cl)CCC(=O)O |
Computed by PubChem (NCBI)