Products 221132-62-3
CAS 221132-62-3 appears in our catalog under these names: (S)-Desmethyl-NNC112/ 99.73% (existing batch purity), (S)-Desmethyl-NNC 112. Offered by: TargetMol, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg.
(5S)-5-(1-benzofuran-7-yl)-8-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-7-ol (CAS 221132-62-3) is a chemical compound with the molecular formula C18H16ClNO2 and a molecular weight of 313.8 g/mol. IUPAC name: (5S)-5-(1-benzofuran-7-yl)-8-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-7-ol. InChIKey: FNSOIGQMVWZWDF-OAHLLOKOSA-N.
| Molecular formula | C18H16ClNO2 |
|---|---|
| Molecular weight | 313.8 g/mol |
| IUPAC name | (5S)-5-(1-benzofuran-7-yl)-8-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-7-ol |
| InChIKey | FNSOIGQMVWZWDF-OAHLLOKOSA-N |
| SMILES | C1CNC[C@@H](C2=CC(=C(C=C21)Cl)O)C3=CC=CC4=C3OC=C4 |
Computed by PubChem (NCBI)