CAS 1461707-22-1 is the registry number for 1-(1-Benzoyl-1,2,3,4-tetrahydroquinolin-6-yl)-2-chloroethan-1-one, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1-(1-benzoyl-3,4-dihydro-2H-quinolin-6-yl)-2-chloroethanone (CAS 1461707-22-1) is a chemical compound with the molecular formula C18H16ClNO2 and a molecular weight of 313.8 g/mol. IUPAC name: 1-(1-benzoyl-3,4-dihydro-2H-quinolin-6-yl)-2-chloroethanone. InChIKey: JPCRYVUYKHLUBW-UHFFFAOYSA-N.
| Molecular formula | C18H16ClNO2 |
|---|---|
| Molecular weight | 313.8 g/mol |
| IUPAC name | 1-(1-benzoyl-3,4-dihydro-2H-quinolin-6-yl)-2-chloroethanone |
| InChIKey | JPCRYVUYKHLUBW-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)C(=O)CCl)N(C1)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)