Products 940995-13-1
CAS 940995-13-1 appears in our catalog under these names: 3-(4-Chlorophenyl)-5-ethyl-1-methyl-1h-indole-2-carboxylic acid, 95%, 3-(4-Chlorophenyl)-5-ethyl-1-methyl-1H-indole-2-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
3-(4-chlorophenyl)-5-ethyl-1-methylindole-2-carboxylic acid (CAS 940995-13-1) is a chemical compound with the molecular formula C18H16ClNO2 and a molecular weight of 313.8 g/mol. IUPAC name: 3-(4-chlorophenyl)-5-ethyl-1-methylindole-2-carboxylic acid. InChIKey: BHCBYCBDVXMFGI-UHFFFAOYSA-N.
| Molecular formula | C18H16ClNO2 |
|---|---|
| Molecular weight | 313.8 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-5-ethyl-1-methylindole-2-carboxylic acid |
| InChIKey | BHCBYCBDVXMFGI-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(C=C1)N(C(=C2C3=CC=C(C=C3)Cl)C(=O)O)C |
Computed by PubChem (NCBI)