CAS 17401-15-9 is the registry number for 2-(2-Methyl-4-phenylquinolin-3-yl)acetic acid hydrochloride, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
2-(2-methyl-4-phenylquinolin-3-yl)acetic acid;hydrochloride (CAS 17401-15-9) is a chemical compound with the molecular formula C18H16ClNO2 and a molecular weight of 313.8 g/mol. IUPAC name: 2-(2-methyl-4-phenylquinolin-3-yl)acetic acid;hydrochloride. InChIKey: FSRDDXOKSKFDFO-UHFFFAOYSA-N.
| Molecular formula | C18H16ClNO2 |
|---|---|
| Molecular weight | 313.8 g/mol |
| IUPAC name | 2-(2-methyl-4-phenylquinolin-3-yl)acetic acid;hydrochloride |
| InChIKey | FSRDDXOKSKFDFO-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC=CC=C2C(=C1CC(=O)O)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)