Products 17401-15-9

CAS 17401-15-9 is the registry number for 2-(2-Methyl-4-phenylquinolin-3-yl)acetic acid hydrochloride, 95+%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-(2-methyl-4-phenylquinolin-3-yl)acetic acid;hydrochloride (CAS 17401-15-9) is a chemical compound with the molecular formula C18H16ClNO2 and a molecular weight of 313.8 g/mol. IUPAC name: 2-(2-methyl-4-phenylquinolin-3-yl)acetic acid;hydrochloride. InChIKey: FSRDDXOKSKFDFO-UHFFFAOYSA-N.

Identity
Molecular formulaC18H16ClNO2
Molecular weight313.8 g/mol
IUPAC name2-(2-methyl-4-phenylquinolin-3-yl)acetic acid;hydrochloride
InChIKeyFSRDDXOKSKFDFO-UHFFFAOYSA-N
SMILESCC1=NC2=CC=CC=C2C(=C1CC(=O)O)C3=CC=CC=C3.Cl

Computed by PubChem (NCBI)