Products 1171401-51-6
CAS 1171401-51-6 is the registry number for 8-Chloro-3,4-dihydro-2H-1,5-benzodioxepin-7-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
7-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-amine;hydrochloride (CAS 1171401-51-6) is a chemical compound with the molecular formula C9H11Cl2NO2 and a molecular weight of 236.09 g/mol. IUPAC name: 7-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-amine;hydrochloride. InChIKey: DLRLKUOINAWJKO-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2NO2 |
|---|---|
| Molecular weight | 236.09 g/mol |
| IUPAC name | 7-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-amine;hydrochloride |
| InChIKey | DLRLKUOINAWJKO-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=C(C(=C2)N)Cl)OC1.Cl |
Computed by PubChem (NCBI)