Products 1171599-40-8

CAS 1171599-40-8 is the registry number for Methyl 4-(1-imino-2,3-dihydro-1H-isoindol-2-yl)benzoate hydrochloride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

Methyl 4-(3-imino-1H-isoindol-2-yl)benzoate;hydrochloride (CAS 1171599-40-8) is a chemical compound with the molecular formula C16H15ClN2O2 and a molecular weight of 302.75 g/mol. IUPAC name: methyl 4-(3-imino-1H-isoindol-2-yl)benzoate;hydrochloride. InChIKey: GTXNMTAOECQRMK-UHFFFAOYSA-N.

Identity
Molecular formulaC16H15ClN2O2
Molecular weight302.75 g/mol
IUPAC namemethyl 4-(3-imino-1H-isoindol-2-yl)benzoate;hydrochloride
InChIKeyGTXNMTAOECQRMK-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=C(C=C1)N2CC3=CC=CC=C3C2=N.Cl

Computed by PubChem (NCBI)