CAS 1171920-75-4 is the registry number for 7-Bromo-2-(chloromethyl)-1-methyl-1h-imidazo[4,5-c]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
7-bromo-2-(chloromethyl)-1-methylimidazo[4,5-c]pyridine (CAS 1171920-75-4) is a chemical compound with the molecular formula C8H7BrClN3 and a molecular weight of 260.52 g/mol. IUPAC name: 7-bromo-2-(chloromethyl)-1-methylimidazo[4,5-c]pyridine. InChIKey: MFEYYVPSWAZRET-UHFFFAOYSA-N.
| Molecular formula | C8H7BrClN3 |
|---|---|
| Molecular weight | 260.52 g/mol |
| IUPAC name | 7-bromo-2-(chloromethyl)-1-methylimidazo[4,5-c]pyridine |
| InChIKey | MFEYYVPSWAZRET-UHFFFAOYSA-N |
| SMILES | CN1C(=NC2=CN=CC(=C21)Br)CCl |
Computed by PubChem (NCBI)