CAS 2488625-51-8 is the registry number for 6-Bromo-4-chloro-2,7-dimethyl-7H-pyrrolo[2,3-d]pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-4-chloro-2,7-dimethylpyrrolo[2,3-d]pyrimidine (CAS 2488625-51-8) is a chemical compound with the molecular formula C8H7BrClN3 and a molecular weight of 260.52 g/mol. IUPAC name: 6-bromo-4-chloro-2,7-dimethylpyrrolo[2,3-d]pyrimidine. InChIKey: YKYVKWCDZDSXBF-UHFFFAOYSA-N.
| Molecular formula | C8H7BrClN3 |
|---|---|
| Molecular weight | 260.52 g/mol |
| IUPAC name | 6-bromo-4-chloro-2,7-dimethylpyrrolo[2,3-d]pyrimidine |
| InChIKey | YKYVKWCDZDSXBF-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C(N2C)Br)C(=N1)Cl |
Computed by PubChem (NCBI)