CAS 885220-89-3 is the registry number for 3-Bromo-7-chloro-2,5-dimethylpyrazolo(1,5-a)pyrimidine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-bromo-7-chloro-2,5-dimethylpyrazolo[1,5-a]pyrimidine (CAS 885220-89-3) is a chemical compound with the molecular formula C8H7BrClN3 and a molecular weight of 260.52 g/mol. IUPAC name: 3-bromo-7-chloro-2,5-dimethylpyrazolo[1,5-a]pyrimidine. InChIKey: XMPNNZUQHXEYBR-UHFFFAOYSA-N.
| Molecular formula | C8H7BrClN3 |
|---|---|
| Molecular weight | 260.52 g/mol |
| IUPAC name | 3-bromo-7-chloro-2,5-dimethylpyrazolo[1,5-a]pyrimidine |
| InChIKey | XMPNNZUQHXEYBR-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C(=NN2C(=C1)Cl)C)Br |
Computed by PubChem (NCBI)