CAS 1626335-83-8 is the registry number for 7-Bromo-4-chloro-1-methyl-1H-indazol-3-amine, 97%. Offered by: Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
7-bromo-4-chloro-1-methylindazol-3-amine (CAS 1626335-83-8) is a chemical compound with the molecular formula C8H7BrClN3 and a molecular weight of 260.52 g/mol. IUPAC name: 7-bromo-4-chloro-1-methylindazol-3-amine. InChIKey: JKVZDIFRPVCPJI-UHFFFAOYSA-N.
| Molecular formula | C8H7BrClN3 |
|---|---|
| Molecular weight | 260.52 g/mol |
| IUPAC name | 7-bromo-4-chloro-1-methylindazol-3-amine |
| InChIKey | JKVZDIFRPVCPJI-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2C(=N1)N)Cl)Br |
Computed by PubChem (NCBI)