CAS 2416917-57-0 is the registry number for 6-Bromo-4-chloro-3-ethyl-3H-imidazo[4,5-c]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-4-chloro-3-ethylimidazo[4,5-c]pyridine (CAS 2416917-57-0) is a chemical compound with the molecular formula C8H7BrClN3 and a molecular weight of 260.52 g/mol. IUPAC name: 6-bromo-4-chloro-3-ethylimidazo[4,5-c]pyridine. InChIKey: UGANQXXXQNUNAW-UHFFFAOYSA-N.
| Molecular formula | C8H7BrClN3 |
|---|---|
| Molecular weight | 260.52 g/mol |
| IUPAC name | 6-bromo-4-chloro-3-ethylimidazo[4,5-c]pyridine |
| InChIKey | UGANQXXXQNUNAW-UHFFFAOYSA-N |
| SMILES | CCN1C=NC2=CC(=NC(=C21)Cl)Br |
Computed by PubChem (NCBI)