Products 1889238-23-6
CAS 1889238-23-6 is the registry number for (R)-3-(4-Bromo-6-chloropyrimidin-5-yl)butanenitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R)-3-(4-bromo-6-chloropyrimidin-5-yl)butanenitrile (CAS 1889238-23-6) is a chemical compound with the molecular formula C8H7BrClN3 and a molecular weight of 260.52 g/mol. IUPAC name: (3R)-3-(4-bromo-6-chloropyrimidin-5-yl)butanenitrile. InChIKey: JJGGLYNMJMNCAE-RXMQYKEDSA-N.
| Molecular formula | C8H7BrClN3 |
|---|---|
| Molecular weight | 260.52 g/mol |
| IUPAC name | (3R)-3-(4-bromo-6-chloropyrimidin-5-yl)butanenitrile |
| InChIKey | JJGGLYNMJMNCAE-RXMQYKEDSA-N |
| SMILES | C[C@H](CC#N)C1=C(N=CN=C1Br)Cl |
Computed by PubChem (NCBI)