Products 117249-17-9
CAS 117249-17-9 is the registry number for 3,4-Di-O-benzyl-L-rhamnal. Offered by: Biosynth. Available pack sizes: 10g.
(2S,3S,4S)-2-methyl-3,4-bis(phenylmethoxy)-3,4-dihydro-2H-pyran (CAS 117249-17-9) is a chemical compound with the molecular formula C20H22O3 and a molecular weight of 310.4 g/mol. IUPAC name: (2S,3S,4S)-2-methyl-3,4-bis(phenylmethoxy)-3,4-dihydro-2H-pyran. InChIKey: QNLJVGMVNHDIKM-VDGAXYAQSA-N.
| Molecular formula | C20H22O3 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | (2S,3S,4S)-2-methyl-3,4-bis(phenylmethoxy)-3,4-dihydro-2H-pyran |
| InChIKey | QNLJVGMVNHDIKM-VDGAXYAQSA-N |
| SMILES | C[C@H]1[C@@H]([C@H](C=CO1)OCC2=CC=CC=C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)