CAS 1173021-09-4 appears in our catalog under these names: Clenproperol-d7, Clenproperol-d7, >95% (HPLC), Clenproperol D7, Clenproperol–D7, D7-Clenproperol, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, GLPBio, TargetMol. Available pack sizes: on request, 1mg, 2,5mg, 25mg, 10mg, 5mg, 50mg, 2.5 mg.
1-(4-amino-3,5-dichlorophenyl)-2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)ethanol (CAS 1173021-09-4) is a chemical compound with the molecular formula C11H16Cl2N2O and a molecular weight of 270.20 g/mol. IUPAC name: 1-(4-amino-3,5-dichlorophenyl)-2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)ethanol. InChIKey: JXUDZCJTCKCTQK-NWOXSKRJSA-N.
| Molecular formula | C11H16Cl2N2O |
|---|---|
| Molecular weight | 270.20 g/mol |
| IUPAC name | 1-(4-amino-3,5-dichlorophenyl)-2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)ethanol |
| InChIKey | JXUDZCJTCKCTQK-NWOXSKRJSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NCC(C1=CC(=C(C(=C1)Cl)N)Cl)O |
Computed by PubChem (NCBI)