Products 1173021-85-6
CAS 1173021-85-6 appears in our catalog under these names: Tetramisole-d5 Hydrochloride, D5-Tetramisole hydrochloride, Concentration: 100 µg/ml Solvent: Acetonitrile, D5-Tetramisole hydrochloride. Offered by: TRC, HPC Standards. Available pack sizes: 25mg, 1x1ml, 1x10mg.
6-(2,3,4,5,6-pentadeuteriophenyl)-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole;hydrochloride (CAS 1173021-85-6) is a chemical compound with the molecular formula C11H13ClN2S and a molecular weight of 245.78 g/mol. IUPAC name: 6-(2,3,4,5,6-pentadeuteriophenyl)-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole;hydrochloride. InChIKey: LAZPBGZRMVRFKY-GWVWGMRQSA-N.
| Molecular formula | C11H13ClN2S |
|---|---|
| Molecular weight | 245.78 g/mol |
| IUPAC name | 6-(2,3,4,5,6-pentadeuteriophenyl)-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole;hydrochloride |
| InChIKey | LAZPBGZRMVRFKY-GWVWGMRQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2CN3CCSC3=N2)[2H])[2H].Cl |
Computed by PubChem (NCBI)