Products 1246819-64-6
CAS 1246819-64-6 appears in our catalog under these names: Levamisole-d5 Hydrochloride, Levamisole-d5 Hydrochloride (1.0 mg/mL in Methanol), Levamisole-d5 Hydrochloride, >95% (HPLC), Levamisole-d5 (hydrochloride), 99.99%. Offered by: Chemat Brand, Hubei YoungXin, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1ml, 1mg.
(6S)-6-(2,3,4,5,6-pentadeuteriophenyl)-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole;hydrochloride (CAS 1246819-64-6) is a chemical compound with the molecular formula C11H13ClN2S and a molecular weight of 245.78 g/mol. IUPAC name: (6S)-6-(2,3,4,5,6-pentadeuteriophenyl)-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole;hydrochloride. InChIKey: LAZPBGZRMVRFKY-ISPSRMEYSA-N.
| Molecular formula | C11H13ClN2S |
|---|---|
| Molecular weight | 245.78 g/mol |
| IUPAC name | (6S)-6-(2,3,4,5,6-pentadeuteriophenyl)-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole;hydrochloride |
| InChIKey | LAZPBGZRMVRFKY-ISPSRMEYSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])[C@H]2CN3CCSC3=N2)[2H])[2H].Cl |
Computed by PubChem (NCBI)