Products 1173188-31-2

CAS 1173188-31-2 is the registry number for 10-O-Allyl-3,8-deshydroxy-9-O-methyl Luteic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

Methyl 4,9-dimethoxy-6-oxo-10-prop-2-enoxybenzo[c]chromene-1-carboxylate (CAS 1173188-31-2) is a chemical compound with the molecular formula C20H18O7 and a molecular weight of 370.4 g/mol. IUPAC name: methyl 4,9-dimethoxy-6-oxo-10-prop-2-enoxybenzo[c]chromene-1-carboxylate. InChIKey: DWNMJAPYGWPHLT-UHFFFAOYSA-N.

Identity
Molecular formulaC20H18O7
Molecular weight370.4 g/mol
IUPAC namemethyl 4,9-dimethoxy-6-oxo-10-prop-2-enoxybenzo[c]chromene-1-carboxylate
InChIKeyDWNMJAPYGWPHLT-UHFFFAOYSA-N
SMILESCOC1=C2C(=C(C=C1)C(=O)OC)C3=C(C=CC(=C3OCC=C)OC)C(=O)O2

Computed by PubChem (NCBI)