CAS 1173188-31-2 is the registry number for 10-O-Allyl-3,8-deshydroxy-9-O-methyl Luteic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
Methyl 4,9-dimethoxy-6-oxo-10-prop-2-enoxybenzo[c]chromene-1-carboxylate (CAS 1173188-31-2) is a chemical compound with the molecular formula C20H18O7 and a molecular weight of 370.4 g/mol. IUPAC name: methyl 4,9-dimethoxy-6-oxo-10-prop-2-enoxybenzo[c]chromene-1-carboxylate. InChIKey: DWNMJAPYGWPHLT-UHFFFAOYSA-N.
| Molecular formula | C20H18O7 |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | methyl 4,9-dimethoxy-6-oxo-10-prop-2-enoxybenzo[c]chromene-1-carboxylate |
| InChIKey | DWNMJAPYGWPHLT-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=C(C=C1)C(=O)OC)C3=C(C=CC(=C3OCC=C)OC)C(=O)O2 |
Computed by PubChem (NCBI)