CAS 135905-53-2 appears in our catalog under these names: Lupinol C, Lupinol C. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 25mg, 50mg, Get quote.
(5aS,10bR)-1,3,8,10b-tetrahydroxy-2-(3-methylbut-2-enyl)-5aH-[1]benzofuro[2,3-b]chromen-11-one (CAS 135905-53-2) is a chemical compound with the molecular formula C20H18O7 and a molecular weight of 370.4 g/mol. IUPAC name: (5aS,10bR)-1,3,8,10b-tetrahydroxy-2-(3-methylbut-2-enyl)-5aH-[1]benzofuro[2,3-b]chromen-11-one. InChIKey: BGGHUJKZYHZOPN-PMACEKPBSA-N.
| Molecular formula | C20H18O7 |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | (5aS,10bR)-1,3,8,10b-tetrahydroxy-2-(3-methylbut-2-enyl)-5aH-[1]benzofuro[2,3-b]chromen-11-one |
| InChIKey | BGGHUJKZYHZOPN-PMACEKPBSA-N |
| SMILES | CC(=CCC1=C(C2=C(C=C1O)O[C@H]3[C@@](C2=O)(C4=C(O3)C=C(C=C4)O)O)O)C |
Computed by PubChem (NCBI)