Products 143724-75-8
CAS 143724-75-8 appears in our catalog under these names: 8-Prenylquercetin, Icariin Impurity 8, Icariin Impurity 7. Offered by: TRC, Chemat Brand, Hubei YoungXin. Available pack sizes: 25mg, on request, 10mg, 50mg, 100mg, 200mg.
2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-8-(3-methylbut-2-enyl)chromen-4-one (CAS 143724-75-8) is a chemical compound with the molecular formula C20H18O7 and a molecular weight of 370.4 g/mol. IUPAC name: 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-8-(3-methylbut-2-enyl)chromen-4-one. InChIKey: ZHTTWVRMGWQEOH-UHFFFAOYSA-N.
| Molecular formula | C20H18O7 |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-8-(3-methylbut-2-enyl)chromen-4-one |
| InChIKey | ZHTTWVRMGWQEOH-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C2C(=C(C=C1O)O)C(=O)C(=C(O2)C3=CC(=C(C=C3)O)O)O)C |
Computed by PubChem (NCBI)