Products 13040-46-5
CAS 13040-46-5 appears in our catalog under these names: Paulownin, Paulownine, paulownin/ 99.9%, Paulownin, 99.88%. Offered by: GLPBio, TRC, TargetMol, MedChemExpress. Available pack sizes: 5mg, 25mg, 1mg, 2mg, 10mg, 50mg, 100mg, 500mg.
3,6-bis(1,3-benzodioxol-5-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan-3a-ol (CAS 13040-46-5) is a chemical compound with the molecular formula C20H18O7 and a molecular weight of 370.4 g/mol. IUPAC name: 3,6-bis(1,3-benzodioxol-5-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan-3a-ol. InChIKey: CAQZFLPWHBKTTR-UHFFFAOYSA-N.
| Molecular formula | C20H18O7 |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | 3,6-bis(1,3-benzodioxol-5-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan-3a-ol |
| InChIKey | CAQZFLPWHBKTTR-UHFFFAOYSA-N |
| SMILES | C1C2C(OCC2(C(O1)C3=CC4=C(C=C3)OCO4)O)C5=CC6=C(C=C5)OCO6 |
Computed by PubChem (NCBI)