Products 120051-54-9
CAS 120051-54-9 is the registry number for Meridinol. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, 5 mg, 1 mg.
(3S,4S)-3,4-bis(1,3-benzodioxol-5-ylmethyl)-3-hydroxyoxolan-2-one (CAS 120051-54-9) is a chemical compound with the molecular formula C20H18O7 and a molecular weight of 370.4 g/mol. IUPAC name: (3S,4S)-3,4-bis(1,3-benzodioxol-5-ylmethyl)-3-hydroxyoxolan-2-one. InChIKey: OTWLSQPCSOEBAY-XOBRGWDASA-N.
| Molecular formula | C20H18O7 |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | (3S,4S)-3,4-bis(1,3-benzodioxol-5-ylmethyl)-3-hydroxyoxolan-2-one |
| InChIKey | OTWLSQPCSOEBAY-XOBRGWDASA-N |
| SMILES | C1[C@@H]([C@](C(=O)O1)(CC2=CC3=C(C=C2)OCO3)O)CC4=CC5=C(C=C4)OCO5 |
Computed by PubChem (NCBI)