Products 2222285-82-5
CAS 2222285-82-5 appears in our catalog under these names: Epimedonin H, Epimedonin H. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
5,7-dihydroxy-8-(2-hydroxy-3-methylbut-3-enyl)-2-(4-hydroxyphenoxy)chromen-4-one (CAS 2222285-82-5) is a chemical compound with the molecular formula C20H18O7 and a molecular weight of 370.4 g/mol. IUPAC name: 5,7-dihydroxy-8-(2-hydroxy-3-methylbut-3-enyl)-2-(4-hydroxyphenoxy)chromen-4-one. InChIKey: BMYNHTLJWIVABZ-UHFFFAOYSA-N.
| Molecular formula | C20H18O7 |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | 5,7-dihydroxy-8-(2-hydroxy-3-methylbut-3-enyl)-2-(4-hydroxyphenoxy)chromen-4-one |
| InChIKey | BMYNHTLJWIVABZ-UHFFFAOYSA-N |
| SMILES | CC(=C)C(CC1=C2C(=C(C=C1O)O)C(=O)C=C(O2)OC3=CC=C(C=C3)O)O |
Computed by PubChem (NCBI)
Synonyms:
Epimedonin H, orb1681065