Products 117342-78-6
CAS 117342-78-6 appears in our catalog under these names: rac-(4-Methylphenyl)-ephedrine Hydrochloride, >95% (HPLC), Mephedrone metabolite (hydrochloride) ((±)–ephedrine stereochemistry), Mephedrone metabolite (hydrochloride) ((±)-ephedrine stereochemistry). Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 100mg, 10mg, 1mg, 5mg, 500μg, 5 mg, 1 mg.
(1S,2R)-2-(methylamino)-1-(4-methylphenyl)propan-1-ol;hydrochloride (CAS 117342-78-6) is a chemical compound with the molecular formula C11H18ClNO and a molecular weight of 215.72 g/mol. IUPAC name: (1S,2R)-2-(methylamino)-1-(4-methylphenyl)propan-1-ol;hydrochloride. InChIKey: DDFKODAFZRBBOK-FOKYBFFNSA-N.
| Molecular formula | C11H18ClNO |
|---|---|
| Molecular weight | 215.72 g/mol |
| IUPAC name | (1S,2R)-2-(methylamino)-1-(4-methylphenyl)propan-1-ol;hydrochloride |
| InChIKey | DDFKODAFZRBBOK-FOKYBFFNSA-N |
| SMILES | CC1=CC=C(C=C1)[C@@H]([C@@H](C)NC)O.Cl |
Computed by PubChem (NCBI)