CAS 27465-53-8 appears in our catalog under these names: 4-Methyl-alpha-(1-(methylamino)ethyl)-benzenemethanol Hydrochloride, d,l-4-Methylephedrine.HCl, d,l-4-Methylephedrine.HCl, 1mg/ml in Methanol (as free base). Offered by: TRC, Lipomed. Available pack sizes: 100mg, 50mg, 10mg, 1ml.
2-(methylamino)-1-(4-methylphenyl)propan-1-ol;hydrochloride (CAS 27465-53-8) is a chemical compound with the molecular formula C11H18ClNO and a molecular weight of 215.72 g/mol. IUPAC name: 2-(methylamino)-1-(4-methylphenyl)propan-1-ol;hydrochloride. InChIKey: DDFKODAFZRBBOK-UHFFFAOYSA-N.
| Molecular formula | C11H18ClNO |
|---|---|
| Molecular weight | 215.72 g/mol |
| IUPAC name | 2-(methylamino)-1-(4-methylphenyl)propan-1-ol;hydrochloride |
| InChIKey | DDFKODAFZRBBOK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(C(C)NC)O.Cl |
Computed by PubChem (NCBI)