Products 1292841-87-2

CAS 1292841-87-2 is the registry number for rac-Methyl Ephedrine-d3 Hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 5mg, 25mg, 10mg.

Structural formula: {0} (CAS {1})

1-(4-methylphenyl)-2-(trideuteriomethylamino)propan-1-ol;hydrochloride (CAS 1292841-87-2) is a chemical compound with the molecular formula C11H18ClNO and a molecular weight of 218.74 g/mol. IUPAC name: 1-(4-methylphenyl)-2-(trideuteriomethylamino)propan-1-ol;hydrochloride. InChIKey: DDFKODAFZRBBOK-FJCVKDQNSA-N.

Identity
Molecular formulaC11H18ClNO
Molecular weight218.74 g/mol
IUPAC name1-(4-methylphenyl)-2-(trideuteriomethylamino)propan-1-ol;hydrochloride
InChIKeyDDFKODAFZRBBOK-FJCVKDQNSA-N
SMILES[2H]C([2H])([2H])NC(C)C(C1=CC=C(C=C1)C)O.Cl

Computed by PubChem (NCBI)