CAS 1292841-87-2 is the registry number for rac-Methyl Ephedrine-d3 Hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 5mg, 25mg, 10mg.
1-(4-methylphenyl)-2-(trideuteriomethylamino)propan-1-ol;hydrochloride (CAS 1292841-87-2) is a chemical compound with the molecular formula C11H18ClNO and a molecular weight of 218.74 g/mol. IUPAC name: 1-(4-methylphenyl)-2-(trideuteriomethylamino)propan-1-ol;hydrochloride. InChIKey: DDFKODAFZRBBOK-FJCVKDQNSA-N.
| Molecular formula | C11H18ClNO |
|---|---|
| Molecular weight | 218.74 g/mol |
| IUPAC name | 1-(4-methylphenyl)-2-(trideuteriomethylamino)propan-1-ol;hydrochloride |
| InChIKey | DDFKODAFZRBBOK-FJCVKDQNSA-N |
| SMILES | [2H]C([2H])([2H])NC(C)C(C1=CC=C(C=C1)C)O.Cl |
Computed by PubChem (NCBI)